Common Name: Lasianthuoside C
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C28H32O14/c1-37-8-14-16(7-13-18(26(14)38-2)20(31)12-6-4-3-5-11(12)19(13)30)41-28-25(36)23(34)22(33)17(42-28)10-40-27-24(35)21(32)15(29)9-39-27/h3-7,15,17,21-25,27-29,32-36H,8-10H2,1-2H3/t15-,17-,21+,22-,23+,24-,25-,27+,28-/m1/s1
InChIKey: InChIKey=NUEGCZCBUUHEIJ-ZIAHVCMJSA-N
Formula: C28H32O14
Molecular Weight: 592.546378
Exact Mass: 592.179206
NMR Solvent: DMSO-d6
MHz:
Calibration:
NMR references: 13C - Li, B., Zhang, D.M., Luo, Y.M., Chen, X.G. Chem Pharm Bull (2006) 54, 297-300
Species:
Notes: Family : Aromatics, Type : Anthraquinones, Group : Anthraquinones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 161.54 |
| 2 (C) | 128.52 |
| 3 (C) | 162.22 |
| 4 (CH) | 109.49 |
| 4a (C) | 137 |
| 5 (CH) | 127.03 |
| 6 (CH) | 134.36 |
| 7 (CH) | 135.42 |
| 8 (CH) | 127.43 |
| 8a (C) | 135.09 |
| 9 (C) | 181.06 |
| 9a (C) | 120.96 |
| 10 (C) | 182.88 |
| 10a (C) | 132.81 |
| 1' (CH) | 101.38 |
| 2' (CH) | 73.9 |
| 3' (CH) | 76.85 |
| 4' (CH) | 70.19 |
| 5' (CH) | 77.12 |
| 6' (CH2) | 68.75 |
| 1'' (CH) | 104.81 |
| 2'' (CH) | 73.98 |
| 3'' (CH) | 76.45 |
| 4'' (CH) | 69.89 |
| 5'' (CH2) | 66.34 |
| 1a (CH3) | 62.67 |
| 2a (CH2) | 63.49 |
| 2b (CH3) | 58.63 |