Common Name: 6-O-[β-D-glucopyranosyl-(1-->4)-α-Lrhamnopyranosyl]-(13E)-cleroda-3,13-dien-15-ol
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C32H54O11/c1-16(11-13-33)10-12-31(5)18(3)14-22(32(6)17(2)8-7-9-21(31)32)42-29-27(39)25(37)28(19(4)40-29)43-30-26(38)24(36)23(35)20(15-34)41-30/h8,11,18-30,33-39H,7,9-10,12-15H2,1-6H3/b16-11+/t18-,19+,20-,21-,22+,23-,24+,25+,26-,27-,28+,29+,30+,31+,32+/m1/s1
InChIKey: InChIKey=BGZWGOQCGUPNJK-FULVCJEYSA-N
Formula: C32H54O11
Molecular Weight: 614.765804
Exact Mass: 614.366613
NMR Solvent: C5D5N
MHz:
Calibration:
NMR references: 13C - Li, X.L., Yang, L.M., Zhao, Y., Wang, R.R., Xu, G., Zheng, Y.T., Tu, L., Peng, L.Y., Cheng, X., Zhao, Q.S. J Nat Prod (2007) 70, 265-8
Species:
Notes: Family : Terpenoids, Type : Diterpenoids, Group : Clerodanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH2) | 17.9 |
| 2 (CH2) | 27 |
| 3 (CH) | 123 |
| 4 (C) | 143.6 |
| 5 (C) | 44 |
| 6 (CH) | 86.2 |
| 7 (CH2) | 35.2 |
| 8 (CH) | 34.3 |
| 9 (C) | 38.6 |
| 10 (CH) | 45.9 |
| 11 (CH2) | 37.2 |
| 12 (CH2) | 25.6 |
| 13 (C) | 140 |
| 14 (CH) | 126.6 |
| 15 (CH2) | 58.7 |
| 16 (CH3) | 23.4 |
| 17 (CH3) | 15.9 |
| 18 (CH3) | 22.9 |
| 19 (CH3) | 16.3 |
| 20 (CH3) | 18 |
| 1' (CH) | 103.3 |
| 2' (CH) | 72.2 |
| 3' (CH) | 72.8 |
| 4' (CH) | 85.2 |
| 5' (CH) | 68.4 |
| 6' (CH3) | 18.2 |
| 1'' (CH) | 106.9 |
| 2'' (CH) | 76.6 |
| 3'' (CH) | 78.6 |
| 4'' (CH) | 71.5 |
| 5'' (CH) | 78.6 |
| 6'' (CH2) | 62.7 |