Common Name: epi-12-Palmatoside G
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C25H32O10/c1-24-9-15(13-6-8-32-11-13)34-22(31)14(24)5-7-25(17(24)3-2-4-18(25)27)12-33-23-21(30)20(29)19(28)16(10-26)35-23/h2,4,6,8,11,14-17,19-21,23,26,28-30H,3,5,7,9-10,12H2,1H3/t14-,15+,16+,17-,19+,20-,21+,23+,24+,25-/m0/s1
InChIKey: InChIKey=YROXDMYKXGMKSM-MVKHKFTQSA-N
Formula: C25H32O10
Molecular Weight: 492.516551
Exact Mass: 492.199547
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Su, C.R., Ueng, Y.F., Dung, N.X., Vijaya Bhaskar Reddy, M., Wu, T.S. J Nat Prod (2007) 70, 1930-3
Species:
Notes: Family : Terpenoids, Type : Diterpenoids, Group : Clerodanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH2) | 24.7 |
| 2 (CH) | 149.6 |
| 3 (CH) | 128.9 |
| 4 (C) | 202.3 |
| 5 (C) | 50.7 |
| 6 (CH2) | 23.9 |
| 7 (CH2) | 18.1 |
| 8 (CH) | 44.8 |
| 9 (C) | 36.8 |
| 10 (CH) | 46.4 |
| 11 (CH2) | 46.9 |
| 12 (CH) | 70.5 |
| 13 (C) | 124.6 |
| 14 (CH) | 108.7 |
| 15 (CH) | 143.9 |
| 16 (CH) | 140.4 |
| 17 (C) | 175.9 |
| 19 (CH2) | 76.2 |
| 20 (CH3) | 25.6 |
| 1' (CH) | 104 |
| 2' (CH) | 73.9 |
| 3' (CH) | 77 |
| 4' (CH) | 70.5 |
| 5' (CH) | 77 |
| 6' (CH2) | 61.7 |