Common Name:
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C24H24N2O6S/c1-23-15(5-7-24-12-30-20(27)16(24)3-2-4-17(23)24)21(28)32-19(23)18(14-6-10-29-11-14)31-22(33)26-9-8-25-13-26/h2-3,6,8-11,13,15-19H,4-5,7,12H2,1H3/t15-,16+,17-,18+,19+,23+,24-/m1/s1
InChIKey: InChIKey=DVUGPQSYBKMFPW-GFBOEHLUSA-N
Formula: C24H24N2O6S1
Molecular Weight: 468.52424
Exact Mass: 468.135507
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Fontana, G., Savona, G., Rodriguez, B., Dersch, C.M., Rothman, R.B., Prisinzano, T.E. Tetrahedron (2008) 64, 10041-8
Species:
Notes: Family : Terpenoids, Type : Diterpenoids, Group : Clerodanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH2) | 22.8 |
| 2 (CH) | 128.9 |
| 3 (CH) | 121 |
| 4 (CH) | 52.2 |
| 5 (C) | 41.3 |
| 6 (CH2) | 31 |
| 7 (CH2) | 16.6 |
| 8 (CH) | 44.1 |
| 9 (C) | 46.1 |
| 10 (CH) | 41.1 |
| 11 (CH) | 85.6 |
| 12 (CH) | 47.3 |
| 13 (C) | 117.6 |
| 14 (CH) | 110.7 |
| 15 (CH) | 144.5 |
| 16 (CH) | 142 |
| 17 (C) | 176.4 |
| 18 (C) | 175.1 |
| 19 (CH2) | 68.5 |
| 20 (CH3) | 16.9 |
| 1' (C) | 223.4 |
| 3' (CH) | 134.9 |
| 4' (CH) | 132 |
| 6' (CH) | 121.9 |