Common Name: 7-Methoxy-8-methylpyrene-2-ol
Synonyms: 7-Methoxy-8-methylpyrene-2-ol
CAS Registry Number:
InChI: InChI=1S/C18H14O2/c1-10-15-6-5-12-8-14(19)7-11-3-4-13(9-16(10)20-2)18(15)17(11)12/h3-9,19H,1-2H3
InChIKey: InChIKey=TWTAZQAHGAVWNP-UHFFFAOYSA-N
Formula: C18H14O2
Molecular Weight: 262.303227
Exact Mass: 262.09938
NMR Solvent: CD3COCD3
MHz:
Calibration:
NMR references: 13C - Yang, G.Z., Li, H.X., Song, F.J., Chen, Y. Helv Chim Acta (2007) 90, 1289-95
Species:
Notes: Family : Aromatics, Type : Pyrenes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 107.6 |
| 2 (C) | 155.3 |
| 3 (C) | 121 |
| 3a (C) | 129.5 |
| 4 (CH) | 124.1 |
| 5 (CH) | 127.3 |
| 5a (C) | 119.6 |
| 6 (CH) | 111.9 |
| 7 (C) | 155.2 |
| 8 (CH) | 111.9 |
| 8a (C) | 132.4 |
| 9 (CH) | 126.3 |
| 10 (CH) | 127.7 |
| 10a (C) | 120.3 |
| 10b (C) | 131.8 |
| 10c (C) | 129.6 |
| 1' (CH3) | 10.8 |
| 2a (CH3) | 55.8 |