Common Name: 5,7,2',3'-tetramethoxyflavanone
Synonyms: 5,7,2',3'-tetramethoxyflavanone
CAS Registry Number:
InChI: InChI=1S/C19H20O6/c1-21-11-8-16(23-3)18-13(20)10-15(25-17(18)9-11)12-6-5-7-14(22-2)19(12)24-4/h5-9,15H,10H2,1-4H3/t15-/m0/s1
InChIKey: InChIKey=LISGXNMNBMLGFM-HNNXBMFYSA-N
Formula: C19H20O6
Molecular Weight: 344.359227
Exact Mass: 344.125988
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Koteswara Rao, Y., Vimalamma, G., Rao, C.V., Tzeng, Y.M. Phytochemistry (2004) 65, 2317-21
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavanones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH) | 74.2 |
| 3 (CH2) | 45 |
| 4 (C) | 189.8 |
| 5 (C) | 162.2 |
| 6 (CH) | 93.9 |
| 7 (C) | 165.8 |
| 8 (CH) | 93.1 |
| 9 (C) | 166.5 |
| 10 (C) | 106.1 |
| 1' (C) | 131.6 |
| 2' (C) | 146.8 |
| 3' (C) | 152.5 |
| 4' (CH) | 112 |
| 5' (CH) | 123.2 |
| 6' (CH) | 117.3 |
| 5a (CH3) | 60.1 |
| 7a (CH3) | 56.5 |
| 2'a (CH3) | 56.2 |
| 3'a (CH3) | 55.4 |