Common Name: Anibamine
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C30H50N/c1-5-7-9-11-13-15-17-19-22-28-26(3)29(30-24-21-25-31(30)27(28)4)23-20-18-16-14-12-10-8-6-2/h19-20,22-23H,5-18,21,24-25H2,1-4H3/q+1/b22-19-,23-20-
InChIKey: InChIKey=LOTZSYKJMYSNJV-IKJQKJQYSA-N
Formula: C30H50N1
Molecular Weight: 424.725858
Exact Mass: 424.394326
NMR Solvent: CD3C≡N
MHz:
Calibration:
NMR references: 13C - Jayasuriya, H., Herath, K.B., Ondeyka, J.G., Polishook, J.D., Bills, G.F., Dombrowski, A.W., Springer, M.S., Siciliano, S., Malkowitz, L., Sanchez, M., Guan, Z., Tiwari, S., Stevenson, D.W., Borris, R.P., Singh, S.B. J Nat Prod (2004) 67, 1036-8
Species:
Notes: Family : Alkaloids, Type : Indolizidines; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH2) | 33 |
| 2 (CH2) | 21.3 |
| 3 (CH2) | 58.6 |
| 5 (C) | 149 |
| 6 (C) | 135.9 |
| 7 (C) | 155.6 |
| 8 (C) | 132.2 |
| 9 (C) | 155.2 |
| 5a (CH3) | 18.3 |
| 6a (CH) | 123 |
| 6b (CH) | 139.5 |
| 6c (CH2) | 29.7 |
| 6d (CH2) | 29.3 |
| 6e (CH2) | 29.95 |
| 6f (CH2) | 30.03 |
| 6g (CH2) | 30.06 |
| 6h (CH2) | 32.6 |
| 6i (CH2) | 23.3 |
| 6j (CH3) | 14.4 |
| 7a (CH3) | 19.1 |
| 8a (CH) | 122.1 |
| 8b (CH) | 139.4 |
| 8c (CH2) | 29.5 |
| 8d (CH2) | 29.2 |
| 8e (CH2) | 29.95 |
| 8f (CH2) | 29.99 |
| 8g (CH2) | 30.06 |
| 8h (CH2) | 32.6 |
| 8i (CH2) | 23.3 |
| 8j (CH3) | 14.4 |