Common Name: Penduletin 4'-methyl ether
Synonyms: Penduletin 4'-methyl ether
CAS Registry Number:
InChI: InChI=1S/C19H18O7/c1-22-11-7-5-10(6-8-11)17-19(25-4)16(21)14-12(26-17)9-13(23-2)18(24-3)15(14)20/h5-9,20H,1-4H3
InChIKey: InChIKey=ADNCDMHZHONBRR-UHFFFAOYSA-N
Formula: C19H18O7
Molecular Weight: 358.34275
Exact Mass: 358.105253
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Sy, L.K., Brown, G.D. Phytochemistry (1998) 48, 1207-11
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavonols; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 156 |
| 3 (C) | 138.8 |
| 4 (C) | 178.8 |
| 5 (C) | 152.8 |
| 6 (C) | 132.4 |
| 7 (C) | 158.8 |
| 8 (CH) | 90.4 |
| 9 (C) | 152.4 |
| 10 (C) | 107.6 |
| 1' (C) | 122.9 |
| 2' (CH) | 130.2 |
| 3' (CH) | 114.1 |
| 4' (C) | 161.7 |
| 5' (CH) | 114.1 |
| 6' (CH) | 130.2 |
| 3a (CH3) | 60.2 |
| 6a (CH3) | 60.9 |
| 7a (CH3) | 56.3 |
| 4'a (CH3) | 55.5 |