Common Name: Briarellin G
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C28H44O6/c1-6-7-8-9-10-11-23(31)34-27(4)13-12-19-18(3)16-32-28(5)22(30)15-20(29)17(2)14-21-25(27)24(19)26(28)33-21/h18-21,24-26,29H,2,6-16H2,1,3-5H3/t18-,19-,20+,21-,24-,25-,26-,27-,28-/m0/s1
InChIKey: InChIKey=ZQASQTQDBVSJFZ-OSTHKSCDSA-N
Formula: C28H44O6
Molecular Weight: 476.646428
Exact Mass: 476.313789
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Rodriguez, A.D., Cobar, O.M. Chem Pharm Bull (1995) 43, 1853-8
Species:
Notes: Family : Terpenoids, Type : Diterpenoids, Group : Eunicellanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 39.19 |
| 2 (CH) | 93.72 |
| 3 (C) | 77.57 |
| 4 (C) | 208.58 |
| 5 (CH2) | 47.33 |
| 6 (CH) | 78.88 |
| 7 (C) | 146.49 |
| 8 (CH2) | 42.22 |
| 9 (CH) | 81.01 |
| 10 (CH) | 46.42 |
| 11 (C) | 81.09 |
| 12 (CH2) | 31.7 |
| 13 (CH2) | 18.52 |
| 14 (CH) | 39.03 |
| 15 (CH) | 35.6 |
| 16 (CH2) | 67.63 |
| 17 (CH3) | 10.33 |
| 18 (CH3) | 21.52 |
| 19 (CH2) | 116.86 |
| 20 (CH3) | 29.22 |
| 11a (C) | 172.89 |
| 11b (CH2) | 34.1 |
| 11c (CH2) | 24.93 |
| 11d (CH2) | 28.89 |
| 11e (CH2) | 28.99 |
| 11f (CH2) | 31.6 |
| 11g (CH2) | 22.57 |
| 11h (CH3) | 14.04 |