Common Name: 2-Methoxy-4-[(1S,2R)-1,3-dihydroxy-2-[2-methoxy-4-(3-hydroxypropyl)phenoxy]propyl]phenol
Synonyms: 2-Methoxy-4-[(1S,2R)-1,3-dihydroxy-2-[2-methoxy-4-(3-hydroxypropyl)phenoxy]propyl]phenol
CAS Registry Number:
InChI: InChI=1S/C20H26O7/c1-25-17-11-14(6-7-15(17)23)20(24)19(12-22)27-16-8-5-13(4-3-9-21)10-18(16)26-2/h5-8,10-11,19-24H,3-4,9,12H2,1-2H3/t19-,20+/m1/s1
InChIKey: InChIKey=DBIKJXXBCAHHMC-UXHICEINSA-N
Formula: C20H26O7
Molecular Weight: 378.417012
Exact Mass: 378.167853
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Huo, C.H., Liang, H., Zhao, Y.Y., Wang, B., Zhang, Q.Y. Phytochemistry (2008) 69, 788-95
Species:
Notes: Family : Lignans, Type : Neolignans, Group : Oxyneolignans; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 131.92 |
| 2 (CH) | 112.53 |
| 3 (C) | 145.24 |
| 4 (C) | 146.76 |
| 5 (CH) | 108.74 |
| 6 (CH) | 121.26 |
| 7 (CH) | 72.86 |
| 8 (CH) | 87.82 |
| 9 (CH2) | 60.9 |
| 1' (C) | 138.42 |
| 2' (CH) | 114.39 |
| 3' (C) | 151.61 |
| 4' (C) | 145.1 |
| 5' (CH) | 119.16 |
| 6' (CH) | 121.45 |
| 7' (CH2) | 32.03 |
| 8' (CH2) | 34.39 |
| 9' (CH2) | 62.34 |
| 3a (CH3) | 56.15 |
| 3'a (CH3) | 56.05 |