Common Name: 2,6-Dimethoxy-4-[(E)-1-propenyl]phenyl 6-O-(beta-D-xylopyranosyl)-beta-D-glucopyranoside
Synonyms: 2,6-Dimethoxy-4-[(E)-1-propenyl]phenyl 6-O-(beta-D-xylopyranosyl)-beta-D-glucopyranoside
CAS Registry Number:
InChI: InChI=1S/C22H32O12/c1-4-5-10-6-12(29-2)20(13(7-10)30-3)34-22-19(28)17(26)16(25)14(33-22)9-32-21-18(27)15(24)11(23)8-31-21/h4-7,11,14-19,21-28H,8-9H2,1-3H3/b5-4+/t11-,14-,15+,16-,17+,18-,19-,21+,22+/m1/s1
InChIKey: InChIKey=PQMJWECTMPFUNZ-LFKGKEESSA-N
Formula: C22H32O12
Molecular Weight: 488.483153
Exact Mass: 488.189376
NMR Solvent: DMSO-d6
MHz:
Calibration:
NMR references: 13C - Huo, C.H., Liang, H., Zhao, Y.Y., Wang, B., Zhang, Q.Y. Phytochemistry (2008) 69, 788-95
Species:
Notes: Family : Aromatics, Type : Phenyl-alkanoids, Group : Phenylpropanoids; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 133.26 |
| 2 (CH) | 103.97 |
| 3 (C) | 152.67 |
| 4 (C) | 133.42 |
| 5 (C) | 152.67 |
| 6 (CH) | 103.97 |
| 7 (CH) | 130.77 |
| 8 (CH) | 124.92 |
| 9 (CH3) | 18.17 |
| 1' (CH) | 102.52 |
| 2' (CH) | 74.02 |
| 3' (CH) | 76.12 |
| 4' (CH) | 69.64 |
| 5' (CH) | 76.37 |
| 6' (CH2) | 68.04 |
| 1'' (CH) | 103.55 |
| 2'' (CH) | 73.28 |
| 3'' (CH) | 76.37 |
| 4'' (CH) | 69.51 |
| 5'' (CH2) | 65.43 |
| 3a (CH3) | 56.32 |
| 5a (CH3) | 56.32 |