Common Name: 2-O-β-D-Glucopyranose-6'-yl-kallolide A
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C26H34O9/c1-11(2)15-7-6-14-9-17(34-25(14)30)19(12(3)4)16-8-13(5)23(33-16)24(15)32-10-18-20(27)21(28)22(29)26(31)35-18/h8-9,15,17-22,24,26-29,31H,1,3,6-7,10H2,2,4-5H3/t15-,17+,18+,19-,20+,21-,22+,24-,26+/m0/s1
InChIKey: InChIKey=MREROPLWFSZAMD-KZVHPPDHSA-N
Formula: C26H34O9
Molecular Weight: 490.543763
Exact Mass: 490.220283
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Rodriguez, A.D., Shi, J.G., Shi, Y.P. J Org Chem (2000) 65, 3192-9
Species:
Notes: Family : Terpenoids, Type : Diterpenoids, Group : Pseudopteranes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 48.7 |
| 2 (CH) | 74.8 |
| 3 (C) | 148.9 |
| 4 (C) | 123.6 |
| 5 (CH) | 113.4 |
| 6 (C) | 153.5 |
| 7 (CH) | 49.3 |
| 8 (CH) | 83 |
| 9 (CH) | 149.5 |
| 10 (C) | 137.6 |
| 11 (CH2) | 22.5 |
| 12 (CH2) | 34.7 |
| 13 (C) | 147.2 |
| 14 (CH2) | 113.7 |
| 15 (CH3) | 18 |
| 16 (CH3) | 9.7 |
| 17 (C) | 144 |
| 18 (CH2) | 114.6 |
| 19 (CH3) | 21.8 |
| 20 (C) | 178 |
| 1' (CH) | 98 |
| 2' (CH) | 78.1 |
| 3' (CH) | 77.2 |
| 4' (CH) | 76.2 |
| 5' (CH) | 72.1 |
| 6' (CH2) | 69.3 |