Common Name: 14,15-dihydropseudopterosin A
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C25H38O6/c1-11(2)8-15-9-13(4)16-7-6-12(3)18-20(16)19(15)14(5)21(27)24(18)31-25-23(29)22(28)17(26)10-30-25/h11-13,15-17,22-23,25-29H,6-10H2,1-5H3/t12-,13-,15-,16+,17+,22-,23+,25-/m0/s1
InChIKey: InChIKey=GTFFROSOVIQFNK-GYGPFBJXSA-N
Formula: C25H38O6
Molecular Weight: 434.566576
Exact Mass: 434.266839
NMR Solvent:
MHz:
Calibration:
NMR references: 13C - Ferns, T., Kerr, R.G. Tetrahedron (2005) 61, 12358-65
Species:
Notes: Family : Terpenoids, Type : Diterpenoids, Group : Amphilectanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 31.1 |
| 2 (CH2) | 40 |
| 3 (CH) | 28 |
| 4 (CH) | 35.4 |
| 5 (CH2) | 26.3 |
| 6 (CH2) | 29.6 |
| 7 (CH) | 26.8 |
| 8 (C) | 128.6 |
| 9 (C) | 140.6 |
| 10 (C) | 144.2 |
| 11 (C) | 121.3 |
| 12 (C) | 135.2 |
| 13 (C) | 133.9 |
| 14 (CH2) | 41.7 |
| 15 (CH) | 25.4 |
| 16 (CH3) | 23.5 |
| 17 (CH3) | 23.6 |
| 18 (CH3) | 21.2 |
| 19 (CH3) | 17.4 |
| 20 (CH3) | 23 |
| 1' (CH) | 106 |
| 2' (CH) | 76.1 |
| 3' (CH) | 74 |
| 4' (CH) | 69.3 |
| 5' (CH2) | 65.1 |