Common Name: Nuttingin F
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C27H41N4O2/c1-20(2)16-24(32)17-23(5)13-9-11-21(3)10-8-12-22(4)14-15-31-18-28-26-25(31)27(33)30(7)19-29(26)6/h10,14,17-20H,8-9,11-13,15-16H2,1-7H3/q+1/b21-10+,22-14+,23-17+
InChIKey: InChIKey=LCRLLIXQRIRQCR-GWKLWHMYSA-N
Formula: C27H41N4O2
Molecular Weight: 453.641222
Exact Mass: 453.322952
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Sorek, H., Rudi, A., Benayahu, Y., Ben-Califa, N., Neumann, D., Kashman, Y. J Nat Prod (2007) 70, 1104-9
Species:
Notes: Family : Terpenoids, Type : Diterpenoids, Group : Phytanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH2) | 45.1 |
| 2 (CH) | 118.7 |
| 3 (C) | 142.3 |
| 4 (CH2) | 39.6 |
| 5 (CH2) | 26.2 |
| 6 (CH) | 124.5 |
| 7 (C) | 135.2 |
| 8 (CH2) | 40 |
| 9 (CH2) | 26 |
| 10 (CH2) | 39 |
| 11 (C) | 158.2 |
| 12 (CH) | 124 |
| 13 (C) | 200.1 |
| 14 (CH2) | 53.1 |
| 15 (CH) | 25.5 |
| 16 (CH3) | 22.6 |
| 17 (CH3) | 22.6 |
| 18 (CH3) | 19.1 |
| 19 (CH3) | 16 |
| 20 (CH3) | 16.7 |
| 2' (CH) | 151.5 |
| 4' (C) | 146.8 |
| 5' (C) | 114.1 |
| 6' (C) | 151.7 |
| 8' (CH) | 145.6 |
| 10' (CH3) | 37.7 |
| 11' (CH3) | 36 |