Common Name: (+)-Pinoresinol
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C20H22O6/c1-23-17-7-11(3-5-15(17)21)19-13-9-26-20(14(13)10-25-19)12-4-6-16(22)18(8-12)24-2/h3-8,13-14,19-22H,9-10H2,1-2H3/t13-,14-,19+,20+/m0/s1
InChIKey: InChIKey=HGXBRUKMWQGOIE-AFHBHXEDSA-N
Formula: C20H22O6
Molecular Weight: 358.385844
Exact Mass: 358.141638
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Moon, S.S., Rahman, A.A., Kim, J.Y., Kee, S.H. Bioorg Med Chem (2008) 16, 7264-9
Species:
Notes: Family : Lignans, Type : Lignans, Group : Bisepoxylignans; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 133.7 |
| 2 (CH) | 111 |
| 3 (C) | 149 |
| 4 (C) | 147.2 |
| 5 (CH) | 116 |
| 6 (CH) | 120 |
| 7 (CH) | 87.6 |
| 8 (CH) | 55.4 |
| 9 (CH2) | 72.7 |
| 1' (C) | 133.7 |
| 2' (CH) | 111 |
| 3' (C) | 149 |
| 4' (C) | 147.2 |
| 5' (CH) | 116 |
| 6' (CH) | 120 |
| 7' (CH) | 87.6 |
| 8' (CH) | 55.4 |
| 9' (CH2) | 72.7 |
| 3a (CH3) | 56.5 |
| 3'a (CH3) | 56.5 |