Common Name: 10-O-(Z)-Cinnamoyl-2-oxo-6-deoxyneoanisatin
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C24H24O8/c1-13-16(25)10-24(29)22(13)11-17(14(2)23(24)12-30-21(23)28)31-20(27)19(22)32-18(26)9-8-15-6-4-3-5-7-15/h3-9,13-14,17,19,29H,10-12H2,1-2H3/b9-8-/t13-,14-,17-,19+,22+,23-,24-/m1/s1
InChIKey: InChIKey=IYGUFLRPYSIVFK-LHWBTFQBSA-N
Formula: C24H24O8
Molecular Weight: 440.443479
Exact Mass: 440.147118
NMR Solvent: P+P
MHz:
Calibration:
NMR references: 13C - Moriyama, M., Huang, J.M., Yang, C.S., Kubo, M., Harada, K., Hioki, H., Fukuyama, Y. Chem Pharm Bull (2008) 56, 1201-4
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Prezizaanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 48.8 |
| 2 (C) | 213.8 |
| 3 (CH2) | 45.7 |
| 4 (C) | 77.3 |
| 5 (C) | 66.3 |
| 6 (CH) | 35.4 |
| 7 (CH) | 79.7 |
| 8 (CH2) | 31 |
| 9 (C) | 50.8 |
| 10 (CH) | 69.6 |
| 11 (C) | 168.7 |
| 12 (CH3) | 12.8 |
| 13 (C) | 171.1 |
| 14 (CH2) | 64.1 |
| 15 (CH3) | 7.4 |
| 1' (C) | 164.1 |
| 2' (CH) | 118 |
| 3' (CH) | 147 |
| 4' (C) | 135 |
| 5' (CH) | 128.8 |
| 6' (CH) | 130.8 |
| 7' (CH) | 130.2 |
| 8' (CH) | 130.8 |
| 9' (CH) | 128.8 |