Common Name: 4-Methoxy-trans-cinnamic acid (1R)-4,4,8aalpha-trimethyl-5beta-hydroxy-7,8beta-diformyl-1,2,3,4,4abeta,5,8,8a-octahydronaphthalene-1alpha-yl ester
Synonyms: 4-Methoxy-trans-cinnamic acid (1R)-4,4,8aalpha-trimethyl-5beta-hydroxy-7,8beta-diformyl-1,2,3,4,4abeta,5,8,8a-octahydronaphthalene-1alpha-yl ester
CAS Registry Number:
InChI: InChI=1S/C25H30O6/c1-24(2)12-11-21(25(3)19(15-27)17(14-26)13-20(28)23(24)25)31-22(29)10-7-16-5-8-18(30-4)9-6-16/h5-10,13-15,19-21,23,28H,11-12H2,1-4H3/b10-7+/t19-,20+,21-,23+,25+/m1/s1
InChIKey: InChIKey=YWTPSTGVICXAEK-NWIQXGLUSA-N
Formula: C25H30O6
Molecular Weight: 426.50305
Exact Mass: 426.204239
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Fomekong-Fotsop, D., Roussi, F., Callonec, C.L., Bousserouel, H., Litaudon, M., Guéritte, F. Tetrahedron (2008) 64, 2192-7
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Drimanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 77 |
| 2 (CH2) | 24.1 |
| 3 (CH2) | 40.1 |
| 4 (C) | 33.1 |
| 5 (CH) | 51.3 |
| 6 (CH) | 68 |
| 7 (CH) | 152.3 |
| 8 (C) | 139.7 |
| 9 (CH) | 54.1 |
| 10 (C) | 44.4 |
| 11 (CH) | 201.6 |
| 12 (CH) | 192.4 |
| 13 (CH3) | 35.5 |
| 14 (CH3) | 22.6 |
| 15 (CH3) | 17.3 |
| 1' (C) | 166.3 |
| 2' (CH) | 115.1 |
| 3' (CH) | 145.4 |
| 4' (C) | 126.8 |
| 5' (CH) | 130 |
| 6' (CH) | 114.4 |
| 7' (C) | 161.6 |
| 8' (CH) | 114.4 |
| 9' (CH) | 130 |
| 7'a (CH3) | 55.4 |