Common Name: Beilschmin B
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C24H32O7/c1-13-14(2)22(16-11-19(27-5)24(30-8)20(12-16)28-6)31-21(13)15-9-17(25-3)23(29-7)18(10-15)26-4/h9-14,21-22H,1-8H3/t13-,14-,21-,22+/m0/s1
InChIKey: InChIKey=ZPINJJOPURFFNV-GKHNXXNSSA-N
Formula: C24H32O7
Molecular Weight: 432.5076
Exact Mass: 432.214803
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Chen, J.J., Chou, E.T., Duh, C.Y., Yang, S.Z., Chen, I.S. Planta Med (2006) 72, 351-7
Species:
Notes: Family : Lignans, Type : Lignans, Group : 7-7-Monoepoxylignans; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 136.7 |
| 2 (CH) | 103.9 |
| 3 (C) | 152.8 |
| 4 (C) | 136.9 |
| 5 (C) | 152.8 |
| 6 (CH) | 103.9 |
| 7 (CH) | 83.2 |
| 8 (CH) | 45.9 |
| 9 (CH3) | 14.8 |
| 1' (C) | 136.5 |
| 2' (CH) | 103.3 |
| 3' (C) | 153.2 |
| 4' (C) | 137.4 |
| 5' (C) | 153.2 |
| 6' (CH) | 103.3 |
| 7' (CH) | 87.3 |
| 8' (CH) | 47.7 |
| 9' (CH3) | 15.3 |
| 3a (CH3) | 55.9 |
| 4a (CH3) | 60.8 |
| 5a (CH3) | 55.9 |
| 3'a (CH3) | 56 |
| 4'a (CH3) | 60.8 |
| 5'a (CH3) | 56 |