Common Name: Lariciresinol-9-O-β-xylopyranoside
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C25H32O10/c1-31-20-8-13(3-5-17(20)26)7-15-10-33-24(14-4-6-18(27)21(9-14)32-2)16(15)11-34-25-23(30)22(29)19(28)12-35-25/h3-6,8-9,15-16,19,22-30H,7,10-12H2,1-2H3/t15-,16-,19-,22+,23-,24+,25-/m1/s1
InChIKey: InChIKey=JFPGZSVWLYGRHH-JRVBPGQWSA-N
Formula: C25H32O10
Molecular Weight: 492.516551
Exact Mass: 492.199547
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Yu, B.C., Yang, M.C., Lee, K.H., Kim, K.H., Choi, S.U., Lee, K.R. Arch Pharm Res (2007) 30, 1471-5
Species:
Notes: Family : Lignans, Type : Lignans, Group : 7-9-Monoepoxylignans; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 132.45 |
| 2 (CH) | 112.36 |
| 3 (C) | 147.81 |
| 4 (C) | 144.62 |
| 5 (CH) | 115.01 |
| 6 (CH) | 121.04 |
| 7 (CH2) | 32.7 |
| 8 (CH) | 42.76 |
| 9 (CH2) | 72.56 |
| 1' (C) | 134.46 |
| 2' (CH) | 109.6 |
| 3' (C) | 147.83 |
| 4' (C) | 145.85 |
| 5' (CH) | 114.83 |
| 6' (CH) | 118.59 |
| 7' (CH) | 83.18 |
| 8' (CH) | 50.49 |
| 9' (CH2) | 62.33 |
| 1'' (CH) | 104.24 |
| 2'' (CH) | 73.85 |
| 3'' (CH) | 76.77 |
| 4'' (CH) | 70.07 |
| 5'' (CH2) | 65.86 |
| 3a (CH3) | 55.29 |
| 3'a (CH3) | 55.29 |