Common Name:
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C22H28O7/c1-25-17-7-5-13(9-19(17)27-3)21(24)16-12-29-22(15(16)11-23)14-6-8-18(26-2)20(10-14)28-4/h5-10,15-16,21-24H,11-12H2,1-4H3/t15-,16+,21-,22-/m1/s1
InChIKey: InChIKey=YHXRGUWLQJECEW-FHTPNYMGSA-N
Formula: C22H28O7
Molecular Weight: 404.454365
Exact Mass: 404.183503
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Lee, J., Lee, D., Jang, D.S., Nam, J.W., Kim, J.P., Park, K.H., Yang, M.S., Seo, E.K. Chem Pharm Bull (2007) 55, 137-9
Species:
Notes: Family : Lignans, Type : Lignans, Group : 7-9-Monoepoxylignans; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 134.2 |
| 2 (CH) | 107.2 |
| 3 (C) | 146.68 |
| 4 (C) | 147.34 |
| 5 (CH) | 109.3 |
| 6 (CH) | 116 |
| 7 (CH) | 70 |
| 8 (CH) | 46.1 |
| 9 (CH2) | 66.5 |
| 1' (C) | 133.1 |
| 2' (CH) | 107.3 |
| 3' (C) | 147.32 |
| 4' (C) | 146.65 |
| 5' (CH) | 109.4 |
| 6' (CH) | 116.3 |
| 7' (CH) | 80.6 |
| 8' (CH) | 49 |
| 9' (CH2) | 58.5 |
| 3a (CH3) | 54.13 |
| 4a (CH3) | 54.16 |
| 3'a (CH3) | 54.13 |
| 4'a (CH3) | 54.16 |