Common Name:
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C22H28O7/c1-25-17-7-5-13(9-19(17)27-3)21(24)16-12-29-22(15(16)11-23)14-6-8-18(26-2)20(10-14)28-4/h5-10,15-16,21-24H,11-12H2,1-4H3/t15-,16-,21+,22-/m0/s1
InChIKey: InChIKey=YHXRGUWLQJECEW-FRMGNDQPSA-N
Formula: C22H28O7
Molecular Weight: 404.454365
Exact Mass: 404.183503
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Lee, J., Lee, D., Jang, D.S., Nam, J.W., Kim, J.P., Park, K.H., Yang, M.S., Seo, E.K. Chem Pharm Bull (2007) 55, 137-9
Species:
Notes: Family : Lignans, Type : Lignans, Group : 7-9-Monoepoxylignans; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 136.7 |
| 2 (CH) | 110.9 |
| 3 (C) | 150.76 |
| 4 (C) | 150.55 |
| 5 (CH) | 112.54 |
| 6 (CH) | 120.55 |
| 7 (CH) | 79 |
| 8 (CH) | 54.8 |
| 9 (CH2) | 71.8 |
| 1' (C) | 134.7 |
| 2' (CH) | 111 |
| 3' (C) | 150.68 |
| 4' (C) | 150.41 |
| 5' (CH) | 112.49 |
| 6' (CH) | 120.41 |
| 7' (CH) | 85.9 |
| 8' (CH) | 57.1 |
| 9' (CH2) | 64.8 |
| 3a (CH3) | 57.36 |
| 4a (CH3) | 57.39 |
| 3'a (CH3) | 57.36 |
| 4'a (CH3) | 57.39 |