Common Name: (7S,8R)-dihydrodehydrodiconiferyl alcohol 9'-O-α-lrhamnoside
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C26H34O10/c1-13-21(29)22(30)23(31)26(35-13)34-8-4-5-14-9-16-17(12-27)24(36-25(16)20(10-14)33-3)15-6-7-18(28)19(11-15)32-2/h6-7,9-11,13,17,21-24,26-31H,4-5,8,12H2,1-3H3/t13-,17-,21-,22+,23+,24+,26+/m0/s1
InChIKey: InChIKey=RVULWJDFVVOGAN-FNMKIYJNSA-N
Formula: C26H34O10
Molecular Weight: 506.543168
Exact Mass: 506.215197
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Sadhu, S.K., Okuyama, E., Fujimoto, H., Ishibashi, M., Yesilada, E. J Ethnopharmacol (2006) 108, 371-8
Species:
Notes: Family : Lignans, Type : Neolignans, Group : Benzofurans; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 134.8 |
| 2 (CH) | 110.6 |
| 3 (C) | 149.1 |
| 4 (C) | 147.5 |
| 5 (CH) | 116.2 |
| 6 (CH) | 119.7 |
| 7 (CH) | 89 |
| 8 (CH) | 55.4 |
| 9 (CH2) | 65 |
| 1' (C) | 136.6 |
| 2' (CH) | 118 |
| 3' (C) | 130 |
| 4' (C) | 147.6 |
| 5' (C) | 145.2 |
| 6' (CH) | 114.2 |
| 7' (CH2) | 33.2 |
| 8' (CH2) | 32.7 |
| 9' (CH2) | 67.7 |
| 1'' (CH) | 101.7 |
| 2'' (CH) | 72.4 |
| 3'' (CH) | 72.5 |
| 4'' (CH) | 74 |
| 5'' (CH) | 69.8 |
| 6'' (CH3) | 18 |
| 3a (CH3) | 56.8 |
| 5'a (CH3) | 56.4 |