Common Name: Vittarin-D
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C23H28O11/c1-31-15-6-4-11(7-16(15)32-2)3-5-12-8-13(9-14(25)18(12)22(29)30)33-23-21(28)20(27)19(26)17(10-24)34-23/h4,6-9,17,19-21,23-28H,3,5,10H2,1-2H3,(H,29,30)/t17-,19-,20+,21-,23-/m1/s1
InChIKey: InChIKey=UWFNGEDWZRNGHV-OXUVVOBNSA-N
Formula: C23H28O11
Molecular Weight: 480.462721
Exact Mass: 480.163162
NMR Solvent: C5D5N
MHz:
Calibration:
NMR references: 13C - Wu, P.L., Hsu, Y.L., Zao, C.W., Damu, A.G., Wu, T.S. J Nat Prod (2005) 68, 1180-4
Species:
Notes: Family : Aromatics, Type : Stilbenes, Group : Stilbenes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 148.4 |
| 2 (C) | 113.7 |
| 3 (C) | 167.3 |
| 4 (CH) | 102.7 |
| 5 (C) | 160.5 |
| 6 (CH) | 109.7 |
| α (CH2) | 39.6 |
| β (CH2) | 38.9 |
| 1' (C) | 137.2 |
| 2' (CH) | 113.5 |
| 3' (C) | 149.9 |
| 4' (C) | 148.1 |
| 5' (CH) | 112.8 |
| 6' (CH) | 121.2 |
| 1'' (CH) | 101.7 |
| 2'' (CH) | 75.1 |
| 3'' (CH) | 78.5 |
| 4'' (CH) | 71.2 |
| 5'' (CH) | 78.7 |
| 6'' (CH2) | 62.2 |
| 2a (C) | 175.9 |
| 3'a (CH3) | 56 |
| 4'a (CH3) | 56.2 |