Common Name: Vittarin-E
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C32H34O8/c1-37-27-11-7-19(13-29(27)39-3)5-9-21-15-23(33)17-25(35)31(21)32-22(16-24(34)18-26(32)36)10-6-20-8-12-28(38-2)30(14-20)40-4/h7-8,11-18,33-36H,5-6,9-10H2,1-4H3
InChIKey: InChIKey=BKHVYSOGHMNESX-UHFFFAOYSA-N
Formula: C32H34O8
Molecular Weight: 546.608774
Exact Mass: 546.225368
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Wu, P.L., Hsu, Y.L., Zao, C.W., Damu, A.G., Wu, T.S. J Nat Prod (2005) 68, 1180-4
Species:
Notes: Family : Aromatics, Type : Stilbenes, Group : Stilbenes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 149 |
| 2 (C) | 106.6 |
| 3 (C) | 166.6 |
| 4 (CH) | 101.9 |
| 5 (C) | 162.9 |
| 6 (CH) | 111.8 |
| α (CH2) | 40 |
| β (CH2) | 39 |
| 1' (C) | 136.9 |
| 2' (CH) | 113.8 |
| 3' (C) | 150.2 |
| 4' (C) | 148.6 |
| 5' (CH) | 113.2 |
| 6' (CH) | 121.8 |
| α' (CH2) | 40 |
| β' (CH2) | 39 |
| 1'' (C) | 149 |
| 2'' (C) | 106.6 |
| 3'' (C) | 166.6 |
| 4'' (CH) | 101.9 |
| 5'' (C) | 162.9 |
| 6'' (CH) | 111.8 |
| 1''' (C) | 136.9 |
| 2''' (CH) | 113.8 |
| 3''' (C) | 150.2 |
| 4''' (C) | 148.6 |
| 5''' (CH) | 113.2 |
| 6''' (CH) | 121.8 |
| 3'a (CH3) | 56.4 |
| 4'a (CH3) | 56.6 |
| 3'''a (CH3) | 56.4 |
| 4'''a (CH3) | 56.6 |