Common Name: 2-(3,4-dihydroxyphenyl)ethyl 6-O-[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]-beta-D-glucopyranoside
Synonyms: 2-(3,4-dihydroxyphenyl)ethyl 6-O-[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]-beta-D-glucopyranoside
CAS Registry Number:
InChI: InChI=1S/C23H26O10/c24-15-5-1-13(2-6-15)4-8-19(27)32-12-18-20(28)21(29)22(30)23(33-18)31-10-9-14-3-7-16(25)17(26)11-14/h1-8,11,18,20-26,28-30H,9-10,12H2/b8-4+/t18-,20-,21+,22-,23-/m1/s1
InChIKey: InChIKey=DNMNWOHCZHSQAI-FZYQUXMESA-N
Formula: C23H26O10
Molecular Weight: 462.447435
Exact Mass: 462.152597
NMR Solvent: DMSO-d6
MHz:
Calibration:
NMR references: 13C - Es-Safi, N.E., Khlifi, S., Kerhoas, L., Kollmann, A., El Abbouyi, A., Ducrot, P.H. J Nat Prod (2005) 68, 1293-6
Species:
Notes: Family : Aromatics, Type : Phenyl-alkanoids, Group : Phenylethanoids; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 132 |
| 2 (CH) | 117.4 |
| 3 (C) | 145.5 |
| 4 (C) | 147.7 |
| 5 (CH) | 115.5 |
| 6 (CH) | 121.8 |
| 7 (CH2) | 37.6 |
| 8 (CH2) | 72.9 |
| 1' (CH) | 105.1 |
| 2' (CH) | 75.6 |
| 3' (CH) | 78.5 |
| 4' (CH) | 72.4 |
| 5' (CH) | 76 |
| 6' (CH2) | 65.3 |
| 1'' (C) | 169.8 |
| 2'' (CH) | 116.9 |
| 3'' (CH) | 147.4 |
| 4'' (C) | 128 |
| 5'' (CH) | 117.8 |
| 6'' (CH) | 131.7 |
| 7'' (C) | 162.1 |
| 8'' (CH) | 131.7 |
| 9'' (CH) | 117.8 |