Common Name: Artelasticinol
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C26H28O8/c1-12(2)6-7-14-16(27)10-20(31)23-24(32)22(19(30)8-13(3)4)26(34-25(14)23)15-9-18(29)21(33-5)11-17(15)28/h6,8-11,19,27-31H,7H2,1-5H3
InChIKey: InChIKey=KAWAJORUQDJNLV-UHFFFAOYSA-N
Formula: C26H28O8
Molecular Weight: 468.496714
Exact Mass: 468.178418
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Ko, H.H., Lu, Y.H., Yang, S.Z., Won, S.J., Lin, C.N. J Nat Prod (2005) 68, 1692-5
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (C) | 158.1 |
| 3 (C) | 109.8 |
| 4 (C) | 178.8 |
| 5 (C) | 154 |
| 6 (CH) | 99.8 |
| 7 (C) | 164.5 |
| 8 (C) | 109.5 |
| 9 (C) | 160.1 |
| 10 (C) | 105.5 |
| 1' (C) | 108.7 |
| 2' (C) | 155.3 |
| 3' (CH) | 102.2 |
| 4' (C) | 160.3 |
| 5' (C) | 109.1 |
| 6' (CH) | 139.3 |
| 1'' (CH) | 69.9 |
| 2'' (CH) | 121 |
| 3'' (C) | 134.6 |
| 4'' (CH3) | 18.6 |
| 5'' (CH3) | 25.9 |
| 1'''' (CH2) | 21.8 |
| 2'''' (CH) | 124.9 |
| 3'''' (C) | 134.7 |
| 4'''' (CH3) | 18 |
| 5'''' (CH3) | 25.7 |
| 4'a (CH3) | 55.6 |