Common Name: 8α-Hydroxy-11α,13-dihydroglucozaluzanin C
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C21H30O9/c1-7-4-11(23)15-9(3)20(27)30-19(15)14-8(2)12(5-10(7)14)28-21-18(26)17(25)16(24)13(6-22)29-21/h9-19,21-26H,1-2,4-6H2,3H3/t9-,10+,11+,12+,13-,14+,15-,16-,17+,18-,19-,21-/m1/s1
InChIKey: InChIKey=ALFNDZUCKXOXII-YIYJKGBESA-N
Formula: C21H30O9
Molecular Weight: 426.458321
Exact Mass: 426.188983
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Li, X.S., Liu, J.Y., Cai, J.N., Cai, P.L. Magn Reson Chem (2008) 46, 1070-3
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Guaianes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 46.3 |
| 2 (CH2) | 38.4 |
| 3 (CH) | 81.6 |
| 4 (C) | 151 |
| 5 (CH) | 52.5 |
| 6 (CH) | 81.2 |
| 7 (CH) | 54.7 |
| 8 (CH) | 70.9 |
| 9 (CH2) | 46 |
| 10 (C) | 145.9 |
| 11 (CH) | 40.5 |
| 12 (C) | 182.5 |
| 13 (CH3) | 11.8 |
| 14 (CH2) | 116.4 |
| 15 (CH2) | 115.7 |
| 1' (CH) | 102.5 |
| 2' (CH) | 75.8 |
| 3' (CH) | 78.8 |
| 4' (CH) | 72.4 |
| 5' (CH) | 78.4 |
| 6' (CH2) | 63.4 |