Common Name: Pulchellamine D
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C24H29NO6/c1-12-8-19(27)21-16(11-25-17(23(28)29)9-14-6-4-3-5-7-14)24(30)31-22(21)20-13(2)18(26)10-15(12)20/h3-7,15-22,25-27H,1-2,8-11H2,(H,28,29)/t15-,16-,17-,18-,19-,20-,21+,22+/m0/s1
InChIKey: InChIKey=UPFWZEIMZFQXJN-QXOHZNJTSA-N
Formula: C24H29N1O6
Molecular Weight: 427.491116
Exact Mass: 427.199488
NMR Solvent: C5D5N
MHz:
Calibration:
NMR references: 13C - Yang, M.C., Choi, S.U., Choi, W.S., Kim, S.Y., Lee, K.R. J Nat Prod (2008) 71, 678-83
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Guaianes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 44.5 |
| 2 (CH2) | 39.9 |
| 3 (CH) | 73.5 |
| 4 (C) | 155 |
| 5 (CH) | 50.6 |
| 6 (CH) | 80.3 |
| 7 (CH) | 64.3 |
| 8 (CH) | 74.4 |
| 9 (CH2) | 45.2 |
| 10 (C) | 145.7 |
| 11 (CH) | 48.9 |
| 12 (C) | 177.2 |
| 13 (CH2) | 49.8 |
| 14 (CH2) | 115.5 |
| 15 (CH2) | 110.3 |
| 13b (CH) | 64.3 |
| 13c (CH2) | 40.2 |
| 13d (C) | 138.8 |
| 13e (CH) | 130.5 |
| 13f (CH) | 129.1 |
| 13g (CH) | 127.3 |
| 13h (CH) | 129.1 |
| 13i (CH) | 130.5 |
| 13ba (C) | 176.4 |