Common Name: Pulchellamine F
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C26H30N2O6/c1-12-7-21(30)23-17(26(33)34-24(23)22-13(2)20(29)9-16(12)22)11-28-19(25(31)32)8-14-10-27-18-6-4-3-5-15(14)18/h3-6,10,16-17,19-24,27-30H,1-2,7-9,11H2,(H,31,32)/t16-,17-,19-,20-,21-,22-,23+,24+/m0/s1
InChIKey: InChIKey=RSGXFKJWMJPECM-XQQBHHJWSA-N
Formula: C26H29N2O6
Molecular Weight: 465.519331
Exact Mass: 465.202562
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Yang, M.C., Choi, S.U., Choi, W.S., Kim, S.Y., Lee, K.R. J Nat Prod (2008) 71, 678-83
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Guaianes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 43.8 |
| 2 (CH2) | 39.3 |
| 3 (CH) | 73.8 |
| 4 (C) | 154.4 |
| 5 (CH) | 50.3 |
| 6 (CH) | 81.2 |
| 7 (CH) | 55 |
| 8 (CH) | 74.2 |
| 9 (CH2) | 46.3 |
| 10 (C) | 145 |
| 11 (CH) | 45.1 |
| 12 (C) | 176.3 |
| 13 (CH2) | 48.1 |
| 14 (CH2) | 116 |
| 15 (CH2) | 110 |
| 13a (CH) | 63.7 |
| 13b (CH2) | 26.4 |
| 13c (C) | 108.3 |
| 13d (C) | 128.8 |
| 13e (CH) | 122.9 |
| 13f (CH) | 120.4 |
| 13g (CH) | 119.5 |
| 13h (CH) | 112.9 |
| 13i (C) | 138.3 |
| 13j (CH) | 125.8 |
| 13aa (C) | 173.6 |