Common Name: Kushenol Q
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C25H30O7/c1-13(2)4-5-15(14(3)12-26)8-18-20(29)10-21(30)24-22(31)11-23(32-25(18)24)17-7-6-16(27)9-19(17)28/h4,6-7,9-10,14-15,23,26-30H,5,8,11-12H2,1-3H3/t14?,15?,23-/m0/s1
InChIKey: InChIKey=ZKKGYEOMZNZTOJ-ITWBZBEWSA-N
Formula: C25H30O7
Molecular Weight: 442.502455
Exact Mass: 442.199153
NMR Solvent: C+M
MHz:
Calibration:
NMR references: 13C - Kuroyanagi, M., Arakawa, T., Hirayama, Y., Hayashi, T. J Nat Prod (1999) 62, 1595-9
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavanones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH) | 75.3 |
| 3 (CH2) | 41.8 |
| 4 (C) | 197.7 |
| 5 (C) | 160.7 |
| 6 (CH) | 96.1 |
| 7 (C) | 161.9 |
| 8 (C) | 107.9 |
| 9 (C) | 164.5 |
| 10 (C) | 102.8 |
| 1' (C) | 116.9 |
| 2' (C) | 155.4 |
| 3' (CH) | 102.9 |
| 4' (C) | 157.8 |
| 5' (CH) | 107.1 |
| 6' (CH) | 128 |
| 1'' (CH2) | 22.8 |
| 2'' (CH) | 35.6 |
| 3'' (CH2) | 28.9 |
| 4'' (CH) | 123.9 |
| 5'' (C) | 131.9 |
| 6'' (CH3) | 17.6 |
| 7'' (CH3) | 25.7 |
| 8'' (CH) | 40.1 |
| 9'' (CH2) | 66.2 |
| 10'' (CH3) | 12.3 |