Common Name: Kushenol X
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C25H28O7/c1-12(2)5-6-14(13(3)4)9-17-19(28)11-20(29)21-22(30)23(31)25(32-24(17)21)16-8-7-15(26)10-18(16)27/h5,7-8,10-11,14,23,25-29,31H,3,6,9H2,1-2,4H3/t14?,23-,25+/m0/s1
InChIKey: InChIKey=ZJRPDIPXWGIHRB-SBCNVUAESA-N
Formula: C25H28O7
Molecular Weight: 440.486573
Exact Mass: 440.183503
NMR Solvent: C+M
MHz:
Calibration:
NMR references: 13C - Kuroyanagi, M., Arakawa, T., Hirayama, Y., Hayashi, T. J Nat Prod (1999) 62, 1595-9
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavononols; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH) | 78.1 |
| 3 (CH) | 72.7 |
| 4 (C) | 196.5 |
| 5 (C) | 158 |
| 6 (CH) | 96.1 |
| 7 (C) | 160.7 |
| 8 (C) | 108.8 |
| 9 (C) | 165.7 |
| 10 (C) | 103.6 |
| 1' (C) | 115.2 |
| 2' (C) | 157.9 |
| 3' (CH) | 100.4 |
| 4' (C) | 155.9 |
| 5' (CH) | 107.8 |
| 6' (CH) | 128.8 |
| 1'' (CH2) | 26.8 |
| 2'' (CH) | 46.9 |
| 3'' (CH2) | 31.3 |
| 4'' (CH) | 123.3 |
| 5'' (C) | 131.6 |
| 6'' (CH3) | 17.7 |
| 7'' (CH3) | 25.6 |
| 8'' (C) | 148.4 |
| 9'' (CH2) | 110.7 |
| 10'' (CH3) | 18.9 |