Common Name: 2,2-Dimethyl-7-[2-(3,4,5-trimethoxyphenyl)ethenyl]-2H-1-benzopyran
Synonyms: 2,2-Dimethyl-7-[2-(3,4,5-trimethoxyphenyl)ethenyl]-2H-1-benzopyran
CAS Registry Number:
InChI: InChI=1S/C22H24O4/c1-22(2)11-10-17-9-8-15(12-18(17)26-22)6-7-16-13-19(23-3)21(25-5)20(14-16)24-4/h6-14H,1-5H3/b7-6+
InChIKey: InChIKey=WPVCFJCNTJKNBK-VOTSOKGWSA-N
Formula: C22H24O4
Molecular Weight: 352.424388
Exact Mass: 352.167459
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Fang, N., Casida, J.E. J Nat Prod (1999) 62, 205-10
Species:
Notes: Family : Aromatics, Type : Stilbenes, Group : Stilbenes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 137.9 |
| 2 (CH) | 103.6 |
| 3 (C) | 153.4 |
| 4 (C) | 133.4 |
| 5 (C) | 153.4 |
| 6 (CH) | 103.6 |
| α (CH) | 126.4 |
| β (CH) | 127.8 |
| 1' (C) | 130.1 |
| 2' (CH) | 124.2 |
| 3' (C) | 152.8 |
| 4' (C) | 121.3 |
| 5' (CH) | 116.5 |
| 6' (CH) | 122.1 |
| 2'' (C) | 76.5 |
| 3'' (CH) | 127.3 |
| 4'' (CH) | 131.1 |
| 5'' (CH3) | 28.1 |
| 6'' (CH3) | 28.1 |
| 3a (CH3) | 56.2 |
| 4a (CH3) | 60.9 |
| 5a (CH3) | 56.2 |