Common Name: Glyasperin H
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C22H24O5/c1-22(2)10-9-16-17(27-22)7-5-13-11-14(12-26-20(13)16)15-6-8-18(24-3)19(23)21(15)25-4/h5-10,14,23H,11-12H2,1-4H3/t14-/m0/s1
InChIKey: InChIKey=KCINTAABQWLKML-AWEZNQCLSA-N
Formula: C22H24O5
Molecular Weight: 368.423792
Exact Mass: 368.162374
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Sairafianpour, M., Kayser, O., Christensen, J., Asfa, M., Witt, M., Staerk, D., Jaroszewski, J.W. J Nat Prod (2002) 65, 1754-8
Species:
Notes: Family : Flavonoids, Type : Isoflavonoids, Group : Isoflavanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH2) | 70.57 |
| 3 (CH) | 31.71 |
| 4 (CH2) | 31.63 |
| 5 (CH) | 129.15 |
| 6 (CH) | 108.7 |
| 7 (C) | 151.94 |
| 8 (C) | 109.92 |
| 9 (C) | 149.71 |
| 10 (C) | 114.35 |
| 1' (C) | 127.53 |
| 2' (C) | 145.36 |
| 3' (C) | 138.7 |
| 4' (C) | 146.67 |
| 5' (CH) | 106.52 |
| 6' (CH) | 116.99 |
| 2'' (C) | 75.6 |
| 3'' (CH) | 128.97 |
| 4'' (CH) | 116.93 |
| 5'' (CH3) | 27.51 |
| 6'' (CH3) | 27.83 |
| 2'a (CH3) | 61.04 |
| 4'a (CH3) | 56.23 |