Common Name: Sophoraflavanone K
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C26H30O7/c1-13(2)6-7-15(14(3)4)8-17-19(28)11-21(30)25-22(31)12-23(33-26(17)25)16-9-24(32-5)20(29)10-18(16)27/h6,9-11,15,23,27-30H,3,7-8,12H2,1-2,4-5H3
InChIKey: InChIKey=MMKLLSLNPNTOCI-UHFFFAOYSA-N
Formula: C26H30O7
Molecular Weight: 454.51319
Exact Mass: 454.199153
NMR Solvent: CD3COCD3
MHz:
Calibration:
NMR references: 13C - Shen, C.C., Lin, T.W., Huang, Y.L., Wan, S.T., Shien, B.J., Chen, C.C. J Nat Prod (2006) 69, 1237-40
Species:
Notes: Family : Flavonoids, Type : Flavonoids, Group : Flavanones; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 2 (CH) | 74.5 |
| 3 (CH2) | 42.2 |
| 4 (C) | 197.2 |
| 5 (C) | 161.8 |
| 6 (CH) | 94.6 |
| 7 (C) | 166.5 |
| 8 (C) | 102.2 |
| 9 (C) | 162.3 |
| 10 (C) | 107.8 |
| 1' (C) | 115.7 |
| 2' (C) | 148 |
| 3' (CH) | 103.6 |
| 4' (C) | 148.4 |
| 5' (C) | 141.4 |
| 6' (CH) | 111.6 |
| 1'' (CH2) | 26.7 |
| 2'' (CH) | 46.9 |
| 3'' (CH2) | 31.5 |
| 4'' (CH) | 123.8 |
| 5'' (C) | 130.9 |
| 6'' (CH3) | 17.3 |
| 7'' (CH3) | 25.2 |
| 8'' (C) | 148.4 |
| 9'' (CH2) | 110.7 |
| 10'' (CH3) | 18.2 |
| 5'a (CH3) | 56.6 |