Common Name: Eupalinilide M
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C20H26O7/c1-10(4-5-21)18(24)26-16-6-13(9-22)14-7-15(23)11(2)8-20(14)17(16)12(3)19(25)27-20/h4,8,13-17,21-23H,3,5-7,9H2,1-2H3/b10-4+/t13-,14-,15-,16-,17+,20+/m0/s1
InChIKey: InChIKey=OLOVLBMTNFPPBP-SSRVQDEESA-N
Formula: C20H26O7
Molecular Weight: 378.417012
Exact Mass: 378.167853
NMR Solvent: DMSO-d6
MHz:
Calibration:
NMR references: 13C - Ye, G., Huang, X.Y., Li, Z.X., Fan, M.S., Huang, C.G. Biochem Syst Ecol (2008) 36, 741-4
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Cadinanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 35.5 |
| 2 (CH2) | 37.7 |
| 3 (CH) | 69.8 |
| 4 (C) | 139.2 |
| 5 (CH) | 124.4 |
| 6 (C) | 71.1 |
| 7 (CH) | 45.4 |
| 8 (CH) | 69.8 |
| 9 (CH2) | 32 |
| 10 (CH) | 47.9 |
| 11 (C) | 138.1 |
| 12 (C) | 168.7 |
| 13 (CH2) | 126.7 |
| 14 (CH3) | 19.4 |
| 15 (CH2) | 63.7 |
| 8a (C) | 165.9 |
| 8b (C) | 126.5 |
| 8c (CH) | 142.2 |
| 8d (CH2) | 58.1 |
| 8ba (CH3) | 12.3 |