Common Name: Euglobal IIb
Synonyms: Euglobal IIb
CAS Registry Number:
InChI: InChI=1S/C23H30O5/c1-13(2)9-16-10-23(7-5-15(6-8-23)14(3)4)28-22-18(12-25)20(26)17(11-24)21(27)19(16)22/h5,7,11-16,26-27H,6,8-10H2,1-4H3
InChIKey: InChIKey=IGHWKBGONDMTMG-UHFFFAOYSA-N
Formula: C23H30O5
Molecular Weight: 386.482173
Exact Mass: 386.209324
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Kozuka, M., Sawada, T., Kasahara, F., Mizuta, E., Amano, T., Komiya, T., Goto, M. Chem Pharm Bull (1982) 30, 1952-63
Species:
Notes: Family : Terpenoids, Type : Meromonoterpenoids, Group : p-Menthanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 76.6 |
| 2 (CH) | 129 |
| 3 (CH) | 136.9 |
| 4 (CH) | 42 |
| 5 (CH2) | 21 |
| 6 (CH2) | 32 |
| 7 (CH2) | 38.7 |
| 8 (CH) | 31.6 |
| 9 (CH3) | 19.1 |
| 10 (CH3) | 19.5 |
| 1' (C) | 105.4 |
| 2' (C) | 163.4 |
| 3' (C) | 104.5 |
| 4' (C) | 167.8 |
| 5' (C) | 103.9 |
| 6' (C) | 169.5 |
| 7' (CH) | 25.3 |
| 8' (CH) | 192 |
| 9' (CH) | 191.4 |
| 10' (CH2) | 43 |
| 11' (CH) | 25.5 |
| 12' (CH3) | 21 |
| 13' (CH3) | 23.9 |