Common Name: Euglobal-Ib
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C23H30O5/c1-12(2)7-14-8-23(6-5-22(13(3)4)9-17(22)23)28-21-16(11-25)19(26)15(10-24)20(27)18(14)21/h10-14,17,26-27H,5-9H2,1-4H3/t14-,17+,22-,23+/m0/s1
InChIKey: InChIKey=DRQVGVASTZKOLP-LLQVLPNTSA-N
Formula: C23H30O5
Molecular Weight: 386.482173
Exact Mass: 386.209324
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Takasaki, M., Konoshima, T., Kozuka, M., Haruna, M., Ito, K., Yoshida, S. Chem Pharm Bull (1994) 42, 2177-9
Species:
Notes: Family : Terpenoids, Type : Meromonoterpenoids, Group : p-Cyclomenthanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 88.59 |
| 2 (CH) | 28.15 |
| 3 (CH2) | 12.34 |
| 4 (C) | 34.37 |
| 5 (CH2) | 24.2 |
| 6 (CH2) | 33.91 |
| 7 (CH2) | 38.04 |
| 8 (CH) | 32.6 |
| 9 (CH3) | 19.57 |
| 10 (CH3) | 19.5 |
| 1' (C) | 106.33 |
| 2' (C) | 165.47 |
| 3' (C) | 104.67 |
| 4' (C) | 167.91 |
| 5' (C) | 104.17 |
| 6' (C) | 169.77 |
| 7' (CH) | 25.96 |
| 8' (CH) | 192.41 |
| 9' (CH) | 191.84 |
| 10' (CH2) | 43.05 |
| 11' (CH) | 25.46 |
| 12' (CH3) | 24.08 |
| 13' (CH3) | 20.85 |