Common Name: Euglobal-G11
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C23H30O5/c1-12(2)8-17(25)19-20(26)15-10-23(13(3)4)7-6-14(5)9-18(23)28-22(15)16(11-24)21(19)27/h9,11-13,18,26-27H,6-8,10H2,1-5H3/t18-,23-/m1/s1
InChIKey: InChIKey=QNRDYJXKJDDFMZ-WZONZLPQSA-N
Formula: C23H30O5
Molecular Weight: 386.482173
Exact Mass: 386.209324
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Umehara, K., Singh, I.P., Etoh, H., Takasaki, M., Konoshima, T. Phytochemistry (1998) 49, 1699-704
Species:
Notes: Family : Terpenoids, Type : Meromonoterpenoids, Group : p-Menthanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 139.7 |
| 2 (CH) | 120.7 |
| 3 (CH) | 76.8 |
| 4 (C) | 33.6 |
| 5 (CH2) | 24.2 |
| 6 (CH2) | 27.3 |
| 7 (CH3) | 22.9 |
| 8 (CH) | 29.6 |
| 9 (CH3) | 16.9 |
| 10 (CH3) | 16.7 |
| 1' (C) | 100.8 |
| 2' (C) | 160.8 |
| 3' (C) | 103.7 |
| 4' (C) | 168 |
| 5' (C) | 103.7 |
| 6' (C) | 171.8 |
| 7' (CH2) | 20.6 |
| 8' (CH) | 191.9 |
| 9' (C) | 206.4 |
| 10' (CH2) | 52.7 |
| 11' (CH) | 25.1 |
| 12' (CH3) | 22.8 |
| 13' (CH3) | 22.8 |