Common Name:
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C30H34O4/c1-7-9-11-13-21-19(5)25(23-17(3)15-33-29(23)27(21)31)26-20(6)22(14-12-10-8-2)28(32)30-24(26)18(4)16-34-30/h7-10,15-16,31-32H,11-14H2,1-6H3/b9-7+,10-8+
InChIKey: InChIKey=SDUWIOYLRQJRAG-FIFLTTCUSA-N
Formula: C30H34O4
Molecular Weight: 458.589682
Exact Mass: 458.24571
NMR Solvent: CD3COCD3
MHz:
Calibration:
NMR references: 13C - Sun, X.B., Xu, Y.J., Qiu, D.F., Yuan, C.S. Helv Chim Acta (2007) 90, 1705-11
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Eremophilanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH2) | 26.92 |
| 2 (CH2) | 32.97 |
| 3 (CH) | 131.51 |
| 4 (CH) | 124.72 |
| 5 (C) | 130.22 |
| 6 (C) | 123.44 |
| 7 (C) | 126.92 |
| 8 (C) | 142.92 |
| 9 (C) | 138.86 |
| 10 (C) | 123.44 |
| 11 (C) | 117.03 |
| 12 (CH) | 141.25 |
| 13 (CH3) | 7.9 |
| 14 (CH3) | 15.42 |
| 15 (CH3) | 17.47 |
| 1' (CH2) | 26.92 |
| 2' (CH2) | 32.97 |
| 3' (CH) | 131.51 |
| 4' (CH) | 124.72 |
| 5' (C) | 130.22 |
| 6' (C) | 123.44 |
| 7' (C) | 126.92 |
| 8' (C) | 142.92 |
| 9' (C) | 138.86 |
| 10' (C) | 123.44 |
| 11' (C) | 117.03 |
| 12' (CH) | 141.25 |
| 13' (CH3) | 7.9 |
| 14' (CH3) | 15.42 |
| 15' (CH3) | 17.47 |