Common Name: 3,3′,4′-O-trimethylellagic acid 4-O-β-Dxyloside
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C22H20O12/c1-28-10-4-7-12-13-8(21(27)33-18(12)16(10)29-2)5-11(17(30-3)19(13)34-20(7)26)32-22-15(25)14(24)9(23)6-31-22/h4-5,9,14-15,22-25H,6H2,1-3H3/t9-,14+,15-,22+/m1/s1
InChIKey: InChIKey=QXQRDKINPINYFD-SCBIHCBJSA-N
Formula: C22H20O12
Molecular Weight: 476.387864
Exact Mass: 476.095476
NMR Solvent: DMSO-d6
MHz:
Calibration:
NMR references: 13C - Zhang, F., Fu, T.J., Peng, S.L., Liu, Z.R., Ding, L.S. J Integr Plant Biol (2005) 47, 251
Species:
Notes: Family : Aromatics, Type : Biphenyls; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 113.7 |
| 2 (C) | 141.9 |
| 3 (C) | 141.2 |
| 4 (C) | 154.4 |
| 5 (CH) | 112.1 |
| 6 (C) | 112.6 |
| 7 (C) | 158.4 |
| 1' (C) | 112.8 |
| 2' (C) | 141.2 |
| 3' (C) | 141 |
| 4' (C) | 151.7 |
| 5' (CH) | 107.6 |
| 6' (C) | 112.3 |
| 7' (C) | 158.3 |
| 1'' (CH) | 101.8 |
| 2'' (CH) | 73.1 |
| 3'' (CH) | 76.2 |
| 4'' (CH) | 69.3 |
| 5'' (CH2) | 65.9 |
| 3a (CH3) | 61.8 |
| 3'a (CH3) | 61.4 |
| 4'a (CH3) | 56.6 |