Common Name: (E)-Resveratrol 3,5-O-b-diglucoside
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C26H32O13/c27-10-17-19(30)21(32)23(34)25(38-17)36-15-7-13(2-1-12-3-5-14(29)6-4-12)8-16(9-15)37-26-24(35)22(33)20(31)18(11-28)39-26/h1-9,17-35H,10-11H2/b2-1+/t17-,18-,19-,20-,21+,22+,23-,24-,25-,26-/m1/s1
InChIKey: InChIKey=LKWXYXPBNAKWNA-VUNDNAJOSA-N
Formula: C26H32O13
Molecular Weight: 552.525502
Exact Mass: 552.184291
NMR Solvent: M+M
MHz:
Calibration:
NMR references: 13C - Larronde, F., Richard, T.elaunay, J.C.ecendit, A., Monti, J.P., Krisa., Merillon, J.M. Planta Med (2005) 71, 888-90
Species:
Notes: Family : Aromatics, Type : Stilbenes, Group : Stilbenes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 140.6 |
| 2 (CH) | 108.8 |
| 3 (C) | 157.7 |
| 4 (CH) | 104.1 |
| 5 (C) | 157.7 |
| 6 (CH) | 108.8 |
| α (CH) | 125.5 |
| β (CH) | 129.6 |
| 1' (C) | 128.2 |
| 2' (CH) | 129.4 |
| 3' (CH) | 115.7 |
| 4' (C) | 159.4 |
| 5' (CH) | 115.7 |
| 6' (CH) | 129.4 |
| 1'' (CH) | 101.6 |
| 2'' (CH) | 74.2 |
| 3'' (CH) | 77.2 |
| 4'' (CH) | 71.3 |
| 5'' (CH) | 77.5 |
| 6'' (CH2) | 62.4 |
| 1''' (CH) | 101.6 |
| 2''' (CH) | 74.2 |
| 3''' (CH) | 77.2 |
| 4''' (CH) | 71.3 |
| 5''' (CH) | 77.5 |
| 6''' (CH2) | 62.4 |