Common Name: lakoochin A
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C26H30O4/c1-16(2)7-11-20-23(28-5)15-24(29-6)21(12-8-17(3)4)26(20)25-13-18-9-10-19(27)14-22(18)30-25/h7-10,13-15,27H,11-12H2,1-6H3
InChIKey: InChIKey=CHDJBHWCUVZCGP-UHFFFAOYSA-N
Formula: C26H30O4
Molecular Weight: 406.514976
Exact Mass: 406.214409
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Puntumchai, A., Kittakoop, P., Rajviroongit, S., Vimuttipong, S., Likhitwitayawuid, K., Thebtaranonth, Y. J Nat Prod (2004) 67, 485-6
Species:
Notes: Family : Aromatics, Type : Stilbenes, Group : Benzofuranoids; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 123.2 |
| 2 (CH) | 120.8 |
| 3 (CH) | 111.5 |
| 4 (C) | 153.3 |
| 5 (CH) | 98.2 |
| 6 (C) | 155.6 |
| α (CH) | 106.2 |
| β (C) | 153 |
| 1' (C) | 131.8 |
| 2' (C) | 122.5 |
| 3' (C) | 156.3 |
| 4' (CH) | 97.3 |
| 5' (C) | 156.3 |
| 6' (C) | 122.5 |
| 1'' (CH2) | 26.5 |
| 2'' (CH) | 123.6 |
| 3'' (C) | 130.3 |
| 4'' (CH3) | 17.6 |
| 5'' (CH3) | 25.7 |
| 1''' (CH2) | 26.5 |
| 2''' (CH) | 123.6 |
| 3''' (C) | 130.3 |
| 4''' (CH3) | 17.6 |
| 5''' (CH3) | 25.7 |
| 3'a (CH3) | 55.9 |
| 5'a (CH3) | 55.9 |