Common Name: 1β-O-E-cinnamoyl-6α-hydroxy-9-epi-polygodial
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C24H28O5/c1-23(2)12-11-20(29-21(28)10-9-16-7-5-4-6-8-16)24(3)18(15-26)17(14-25)13-19(27)22(23)24/h4-10,13-15,18-20,22,27H,11-12H2,1-3H3/b10-9+/t18-,19+,20-,22+,24+/m1/s1
InChIKey: InChIKey=RJMZKVMAXFDSJD-UPCCYMMLSA-N
Formula: C24H28O5
Molecular Weight: 396.477027
Exact Mass: 396.193674
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Allouche, N., Apel, C., Martin, M.T., Dumontet, V., Gueritte, F., Litaudon, M. Phytochemistry (2009) 70, 546-53
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Drimanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 76.3 |
| 2 (CH2) | 24 |
| 3 (CH2) | 40 |
| 4 (C) | 33.1 |
| 5 (CH) | 51.2 |
| 6 (CH) | 67.9 |
| 7 (CH) | 152.4 |
| 8 (C) | 137 |
| 9 (CH) | 54 |
| 10 (C) | 44.3 |
| 11 (CH) | 201.6 |
| 12 (CH) | 192.6 |
| 13 (CH3) | 34.8 |
| 14 (CH3) | 22.5 |
| 15 (CH3) | 17.2 |
| 1' (C) | 166.2 |
| 2' (CH) | 117.7 |
| 3' (CH) | 145.7 |
| 4' (C) | 134.1 |
| 5' (CH) | 128.2 |
| 6' (CH) | 128.9 |
| 7' (CH) | 130.5 |
| 8' (CH) | 128.9 |
| 9' (CH) | 128.2 |