Common Name: (E)-4-Methoxycinnamic acid (1R)-1alpha,5alpha-dihydroxy-6,6,9abeta-trimethyl-1,3,5,5aalpha,6,7,8,9,9a,9balpha-decahydronaphtho[1,2-c]furan-9beta-yl ester
Synonyms: (E)-4-Methoxycinnamic acid (1R)-1alpha,5alpha-dihydroxy-6,6,9abeta-trimethyl-1,3,5,5aalpha,6,7,8,9,9a,9balpha-decahydronaphtho[1,2-c]furan-9beta-yl ester
CAS Registry Number:
InChI: InChI=1S/C25H32O6/c1-24(2)12-11-19(31-20(27)10-7-15-5-8-17(29-4)9-6-15)25(3)21-16(14-30-23(21)28)13-18(26)22(24)25/h5-10,13,18-19,21-23,26,28H,11-12,14H2,1-4H3/b10-7+/t18-,19+,21+,22-,23+,25+/m0/s1
InChIKey: InChIKey=MMSGKHKMLLCENK-NMAMHUQYSA-N
Formula: C25H32O6
Molecular Weight: 428.518931
Exact Mass: 428.219889
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Allouche, N., Apel, C., Martin, M.T., Dumontet, V., Gueritte, F., Litaudon, M. Phytochemistry (2009) 70, 546-53
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Drimanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 80.3 |
| 2 (CH2) | 24.6 |
| 3 (CH2) | 40.6 |
| 4 (C) | 33.2 |
| 5 (CH) | 57.7 |
| 6 (CH) | 68.2 |
| 7 (CH) | 120 |
| 8 (C) | 139.9 |
| 9 (CH) | 60.2 |
| 10 (C) | 42 |
| 11 (CH) | 99.6 |
| 12 (CH2) | 68.1 |
| 13 (CH3) | 35.2 |
| 14 (CH3) | 22.3 |
| 15 (CH3) | 10.8 |
| 1' (C) | 166.4 |
| 2' (CH) | 115.9 |
| 3' (CH) | 144.1 |
| 4' (C) | 127 |
| 5' (CH) | 129.7 |
| 6' (CH) | 114.3 |
| 7' (C) | 161.4 |
| 8' (CH) | 114.3 |
| 9' (CH) | 129.7 |
| 7'a (CH3) | 55.3 |