Common Name: 1β-hydroxyl-15-O-( p-methoxyphenylacetyl)-5α, 6β, 11βH-eudesma-3-en-12, 6α-olide
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C24H30O6/c1-14-18-10-11-24(2)19(25)9-6-16(21(24)22(18)30-23(14)27)13-29-20(26)12-15-4-7-17(28-3)8-5-15/h4-8,14,18-19,21-22,25H,9-13H2,1-3H3/t14-,18-,19+,21+,22-,24-/m0/s1
InChIKey: InChIKey=HGXKRNRXAGDTHR-RQGNXEPMSA-N
Formula: C24H30O6
Molecular Weight: 414.492314
Exact Mass: 414.204239
NMR Solvent: CD3OD
MHz:
Calibration:
NMR references: 13C - Han, Y.F., Cao, G.X., Xia, M. Chin Chem Lett (2009) 20, 1211-4
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Eudesmanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 81 |
| 2 (CH2) | 31 |
| 3 (CH) | 129.7 |
| 4 (C) | 131.5 |
| 5 (CH) | 49.8 |
| 6 (CH) | 81.5 |
| 7 (CH) | 53.5 |
| 8 (CH2) | 23.8 |
| 9 (CH2) | 34.9 |
| 10 (C) | 40.4 |
| 11 (CH) | 41 |
| 12 (C) | 180.5 |
| 13 (CH3) | 12.4 |
| 14 (CH3) | 12.2 |
| 15 (CH2) | 68.2 |
| 1' (C) | 172.2 |
| 2' (CH2) | 41.4 |
| 3' (C) | 126.9 |
| 4' (CH) | 131.2 |
| 5' (CH) | 114.4 |
| 6' (C) | 159.1 |
| 7' (CH) | 114.4 |
| 8' (CH) | 131.2 |
| 6'a (CH3) | 55.5 |