Common Name: (2S)-Tetrahydro-2alpha-(4-acetoxy-3-methoxyphenyl)-4beta-[[3-methoxy-4-[(1R,2R)-2-acetoxy-1-(acetoxymethyl)-2-(4-acetoxy-3-methoxyphenyl)ethoxy]phenyl]methyl]-3beta-furanmethanol acetate
Synonyms: (2S)-Tetrahydro-2alpha-(4-acetoxy-3-methoxyphenyl)-4beta-[[3-methoxy-4-[(1R,2R)-2-acetoxy-1-(acetoxymethyl)-2-(4-acetoxy-3-methoxyphenyl)ethoxy]phenyl]methyl]-3beta-furanmethanol acetate
CAS Registry Number:
InChI: InChI=1S/C40H46O15/c1-22(41)49-20-31-30(19-51-39(31)28-10-13-32(52-24(3)43)36(17-28)47-7)15-27-9-12-34(35(16-27)46-6)55-38(21-50-23(2)42)40(54-26(5)45)29-11-14-33(53-25(4)44)37(18-29)48-8/h9-14,16-18,30-31,38-40H,15,19-21H2,1-8H3/t30-,31-,38+,39+,40+/m0/s1
InChIKey: InChIKey=XMANHJUDBOHVSB-FBKFKDMTSA-N
Formula: C40H46O15
Molecular Weight: 766.785784
Exact Mass: 766.283671
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Barrero, A.F., Haidour, A., Dorado, M.M., Cuerva, J.M. Phytochemistry (1996) 41, 605-9
Species:
Notes: Family : Lignans, Type : Lignans, Group : 7-9-Monoepoxylignans; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 135.2 |
| 2 (CH) | 112.98 |
| 3 (C) | 150.86 |
| 4 (C) | 146 |
| 5 (CH) | 118.94 |
| 6 (CH) | 120.75 |
| 7 (CH2) | 33.26 |
| 8 (CH) | 42.26 |
| 9 (CH2) | 72.88 |
| 1' (C) | 138.9 |
| 2' (CH) | 109.8 |
| 3' (C) | 150.86 |
| 4' (C) | 141.6 |
| 5' (CH) | 122.19 |
| 6' (CH) | 117.85 |
| 7' (CH) | 82.95 |
| 8' (CH) | 49.07 |
| 9' (CH2) | 62.76 |
| 1'' (C) | 135.4 |
| 2'' (CH) | 111.88 |
| 3'' (C) | 151.17 |
| 4'' (C) | 140 |
| 5'' (CH) | 122.89 |
| 6'' (CH) | 119.64 |
| 7'' (CH) | 74.51 |
| 8'' (CH) | 80.4 |
| 9'' (CH2) | 63.06 |
| 3a (CH3) | 55.9 |
| 3'a (CH3) | 55.9 |
| 4'a (C) | 169.2 |
| 4'b (CH3) | 20.86 |
| 9'a (C) | 169.01 |
| 9'b (CH3) | 20.69 |
| 3''a (CH3) | 55.9 |
| 4''a (C) | 171.07 |
| 4''b (CH3) | 20.69 |
| 7''a (C) | 170.9 |
| 7''b (CH3) | 20.91 |
| 9''a (C) | 169.01 |
| 9''b (CH3) | 20.69 |