Common Name: 5-[(2S,3S)-2,3-Bis(methoxymethyl)-4-(3,4-dimethoxyphenyl)butyl]-7-methoxy-1,3-benzodioxole
Synonyms: 5-[(2S,3S)-2,3-Bis(methoxymethyl)-4-(3,4-dimethoxyphenyl)butyl]-7-methoxy-1,3-benzodioxole
CAS Registry Number:
InChI: InChI=1S/C24H32O7/c1-25-13-18(8-16-6-7-20(27-3)21(10-16)28-4)19(14-26-2)9-17-11-22(29-5)24-23(12-17)30-15-31-24/h6-7,10-12,18-19H,8-9,13-15H2,1-5H3/t18-,19-/m1/s1
InChIKey: InChIKey=RCFGIEPQSDGMJJ-RTBURBONSA-N
Formula: C24H32O7
Molecular Weight: 432.5076
Exact Mass: 432.214803
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Satyanarayana, P., Venkateswarlu, S. Tetrahedron (1991) 47, 8931-40
Species:
Notes: Family : Lignans, Type : Lignans, Group : Dibenzylbutanes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 135.7 |
| 2 (CH) | 103.21 |
| 3 (C) | 143.37 |
| 4 (C) | 133.26 |
| 5 (C) | 148.69 |
| 6 (CH) | 108.29 |
| 7 (CH2) | 35.49 |
| 8 (CH) | 40.93 |
| 9 (CH2) | 72.6 |
| 1' (C) | 133.95 |
| 2' (CH) | 112.31 |
| 3' (C) | 148.85 |
| 4' (C) | 147.25 |
| 5' (CH) | 111.15 |
| 6' (CH) | 121.13 |
| 7' (CH2) | 34.94 |
| 8' (CH) | 40.78 |
| 9' (CH2) | 72.71 |
| 3a (CH2) | 101.14 |
| 5a (CH3) | 55.75 |
| 9a (CH3) | 58.71 |
| 3'a (CH3) | 55.9 |
| 4'a (CH3) | 55.5 |
| 9'a (CH3) | 58.71 |