Common Name: (-)-2-geranyl-3-hydroxy-8,9-ethylenedioxypterocarpan
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C26H28O5/c1-15(2)5-4-6-16(3)7-8-17-9-19-22(11-21(17)27)28-13-20-18-10-24-25(30-14-29-24)12-23(18)31-26(19)20/h5,7,9-12,20,26-27H,4,6,8,13-14H2,1-3H3/b16-7+/t20-,26-/m0/s1
InChIKey: InChIKey=GWPLWWRLEHMIPE-HPRYFGGTSA-N
Formula: C26H28O5
Molecular Weight: 420.498499
Exact Mass: 420.193674
NMR Solvent: C6D6
MHz:
Calibration:
NMR references: 13C - Vieira, N.C., Espindola, L.S., Santana, J.M., Veras, M.L., Pessoa, O.D.L., Pinheiro, S.M., Araujo, R.M.d., Limac, M.A.S., Silveira, E.R. Bioorg Med Chem (2008) 16, 1676
Species:
Notes: Family : Flavonoids, Type : Pterocarpanoids; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (CH) | 132.7 |
| 2 (C) | 122.1 |
| 3 (C) | 156.4 |
| 4 (CH) | 104.4 |
| 4a (C) | 155.9 |
| 6 (CH2) | 66.9 |
| 6a (CH) | 41.1 |
| 6b (C) | 118.9 |
| 7 (CH) | 105.4 |
| 8 (C) | 142.4 |
| 9 (C) | 149 |
| 10 (CH) | 94.3 |
| 10a (C) | 155.4 |
| 11a (CH) | 79.3 |
| 11b (C) | 113.3 |
| 1' (CH2) | 29.2 |
| 2' (CH) | 123.2 |
| 3' (C) | 137.7 |
| 4' (CH2) | 40.3 |
| 5' (CH2) | 27.2 |
| 6' (CH) | 125 |
| 7' (C) | 131.8 |
| 8' (CH3) | 26.1 |
| 9' (CH3) | 18 |
| 10' (CH3) | 16.4 |
| 1'' (CH2) | 101.5 |