Spektraris NMR
Carabrolactone B
Common Name: Carabrolactone B
Synonyms: Carabrolactone B
CAS Registry Number:
InChI: InChI=1S/C15H22O4/c1-7-6-10-12(8(2)14(18)19-10)13(17)15(3)9(7)4-5-11(15)16/h7,9-13,16-17H,2,4-6H2,1,3H3/t7-,9+,10+,11+,12-,13+,15+/m1/s1
InChIKey: InChIKey=BKVXPJGDTWUKIM-FJBRTZCWSA-N
Formula: C15H22O4
Molecular Weight: 266.333355
Exact Mass: 266.151809
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Wang, F., Yang, K., Ren, F.C., Liu, J.K. Fitoterapia (2009) 80, 21-4
Species:
Notes: Family : Terpenoids, Type : Sesquiterpenoids, Group : Guaianes; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
Carbon NMR Peaks
| Position | PPM |
|---|---|
| 1 (CH) | 44.2 |
| 2 (CH2) | 25.6 |
| 3 (CH2) | 27 |
| 4 (CH) | 76.5 |
| 5 (C) | 50 |
| 6 (CH) | 77.3 |
| 7 (CH) | 51.9 |
| 8 (CH) | 77 |
| 9 (CH2) | 44.1 |
| 10 (CH) | 30.9 |
| 11 (C) | 139.3 |
| 12 (C) | 170.8 |
| 13 (CH2) | 123 |
| 14 (CH3) | 20.5 |
| 15 (CH3) | 16.1 |
