Common Name:
Synonyms:
CAS Registry Number:
InChI: InChI=1S/C22H24O9/c1-13(23)28-12-17-18(24)19(25)20(26)22(31-17)30-16-10-6-5-9-15(16)11-29-21(27)14-7-3-2-4-8-14/h2-10,17-20,22,24-26H,11-12H2,1H3/t17-,18-,19+,20-,22-/m1/s1
InChIKey: InChIKey=CKCUUKXLYZDERN-OUUKCGNVSA-N
Formula: C22H24O9
Molecular Weight: 432.421412
Exact Mass: 432.142032
NMR Solvent: CDCl3
MHz:
Calibration:
NMR references: 13C - Ma, Z.J., Meng, Z.K., Zhang, P. Fitoterapia (2009) 80, 374-6
Species:
Notes: Family : Aromatics, Type : Phenyl-alkanoids, Group : Phenylmethanoids; 13 C Spectrum from Naproc 13: José Luis López-Pérez, Roberto Therón, Esther del Olmo, David Díaz: NAPROC-13: a database for the dereplication of natural product mixtures in bioassay-guided protocols. Bioinformatics 23(23):3256-3257 (2007)
| Position | PPM |
|---|---|
| 1 (C) | 129.8 |
| 2 (CH) | 129.8 |
| 3 (CH) | 128.4 |
| 4 (CH) | 133.3 |
| 5 (CH) | 128.4 |
| 6 (CH) | 129.8 |
| 7 (C) | 167 |
| 1' (C) | 125.3 |
| 2' (CH) | 131.1 |
| 3' (CH) | 123.1 |
| 4' (CH) | 130.4 |
| 5' (CH) | 115.5 |
| 6' (C) | 155.8 |
| 7' (CH2) | 61.8 |
| 1'' (CH) | 102.1 |
| 2'' (CH) | 73.5 |
| 3'' (CH) | 74.1 |
| 4'' (CH) | 69.7 |
| 5'' (CH) | 75.8 |
| 6'' (CH2) | 63.2 |
| 6''a (C) | 171.5 |
| 6''b (CH3) | 20.8 |